Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Nateglinide(Starlix) is an insulin secretagog agent that lowers blood glucose levels by stimulating insulin secretion from the pancreas. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10629 |
|---|---|
| Formula | C19H27NO3 |
| Molecular Weight | 317.43 |
| CAS Number | 105816-04-4 |
| SMILES | CC(C)C1CCC(CC1)C(=O)N[C@H](CC2=CC=CC=C2)C(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (179.57 mM) | |
| Water | Insoluble | ||
| Ethanol | 57 mg/mL (179.57 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.5 mL | 157.52 mL | 315.03 mL |
| 0.5 mM | 6.3 mL | 31.5 mL | 63.01 mL |
| 1 mM | 3.15 mL | 15.75 mL | 31.5 mL |
| 5 mM | 0.63 mL | 3.15 mL | 6.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
