Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NBQX is a potent, selective and competitive AMPA receptor antagonist. |
|---|
| Catalog Num | A13109 |
|---|---|
| Formula | C12H8N4O6S |
| Molecular Weight | 336.28 |
| CAS Number | 118876-58-7 |
| SMILES | C1=CC2=C3C(=CC(=C2C(=C1)S(=O)(=O)N)[N+](=O)[O-])NC(=O)C(=O)N3 |
| Synonyms | FG9202 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 64 mg/mL (190.31 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.74 mL | 148.69 mL | 297.37 mL |
| 0.5 mM | 5.95 mL | 29.74 mL | 59.47 mL |
| 1 mM | 2.97 mL | 14.87 mL | 29.74 mL |
| 5 mM | 0.59 mL | 2.97 mL | 5.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
