Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Necrosulfonamide is a pharmacological inhibitor of MLKL with IC50 values of 124 nM in human HT-29. |
|---|
| Catalog Num | A16334 |
|---|---|
| Formula | C18H15N5O6S2 |
| Molecular Weight | 461.47 |
| CAS Number | 1360614-48-7 |
| SMILES | O=S(NC1=NC=CN=C1OC)(C(C=C2)=CC=C2NC(/C=C\C3=CC=C([N+]([O-])=O)S3)=O)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 78 mg/mL (169.02 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.67 mL | 108.35 mL | 216.7 mL |
| 0.5 mM | 4.33 mL | 21.67 mL | 43.34 mL |
| 1 mM | 2.17 mL | 10.83 mL | 21.67 mL |
| 5 mM | 0.43 mL | 2.17 mL | 4.33 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
