Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Neferine is the major bisbenzylisoquinoline alkaloid isolated from the seed embryo of a traditional medicinal plant Nelumbo nucifera (Lotus). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14743 |
|---|---|
| Formula | C38H44N2O6 |
| Molecular Weight | 624.77 |
| CAS Number | 2292-16-2 |
| SMILES | CN1CCC2=CC(=C(C=C2C1CC3=CC=C(C=C3)OC)OC4=C(C=CC(=C4)CC5C6=CC(=C(C=C6CCN5C)OC)OC)O)OC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 88 mg/mL (140.84 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.01 mL | 80.03 mL | 160.06 mL |
| 0.5 mM | 3.2 mL | 16.01 mL | 32.01 mL |
| 1 mM | 1.6 mL | 8 mL | 16.01 mL |
| 5 mM | 0.32 mL | 1.6 mL | 3.2 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
