Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nepicastat is an inhibitor of dopamine beta-hydroxylase, an enzyme that catalyzes the conversion of dopamine to norepinephrine. |
|---|
| Catalog Num | A10637 |
|---|---|
| Formula | C14H15F2N3S |
| Molecular Weight | 295.4 |
| CAS Number | 173997-05-2 |
| SMILES | C1CC2=C(C=C(C=C2C[C@H]1N3C(=CNC3=S)CN)F)F |
| Synonyms | RS-25560-197 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 61 mg/mL (183.83 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 30% propylene glycol, 5% Tween 80, 65% D5W | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.85 mL | 169.26 mL | 338.52 mL |
| 0.5 mM | 6.77 mL | 33.85 mL | 67.7 mL |
| 1 mM | 3.39 mL | 16.93 mL | 33.85 mL |
| 5 mM | 0.68 mL | 3.39 mL | 6.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
