Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ningetinib is a multi-kinase inhibitor that inhibits c-Met, VEGFR2/KDR, and Axl with IC50s value of 19, 37, and 11 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17042 |
|---|---|
| Formula | C31H29FN4O5 |
| Molecular Weight | 556.6 |
| CAS Number | 1394820-69-9 |
| SMILES | FC1=CC(NC(C2=C(C)N(C)N(C3=CC=CC=C3)C2=O)=O)=CC=C1OC4=CC=NC5=C4C=CC(OCC(O)(C)C)=C5 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 18 mg/mL (32.34 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 17.97 mL | 89.83 mL | 179.66 mL |
| 0.5 mM | 3.59 mL | 17.97 mL | 35.93 mL |
| 1 mM | 1.8 mL | 8.98 mL | 17.97 mL |
| 5 mM | 0.36 mL | 1.8 mL | 3.59 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
