Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | NU7026 is a novel DNA-dependent protein kinase inhibitor that potentiates the cytotoxicity of topoisomerase II poisons used in the treatment of leukemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12752 |
|---|---|
| Formula | C17H15NO3 |
| Molecular Weight | 281.31 |
| CAS Number | 154447-35-5 |
| SMILES | C1COCCN1C2=CC(=O)C3=C(O2)C4=CC=CC=C4C=C3 |
| Synonyms | NU 7026, NU-7026 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 1 mg/mL (3.55 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.55 mL | 177.74 mL | 355.48 mL |
| 0.5 mM | 7.11 mL | 35.55 mL | 71.1 mL |
| 1 mM | 3.55 mL | 17.77 mL | 35.55 mL |
| 5 mM | 0.71 mL | 3.55 mL | 7.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
