Loading distributor info...
| Description | O-Phospho-L-serine is the immediate precursor to L-serine in the serine synthesis pathway, and an agonist at the group III mGluR receptors (mGluR4, mGluR6, mGluR7, and mGluR8); O-Phospho-L-serine also acts as a weak antagonist for mGluR1 and a potent antagonist for mGluR2. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A21159 |
|---|---|
| Formula | C3H8NO6P |
| Molecular Weight | 185.07 |
| CAS Number | 407-41-0 |
| SMILES | OP(OC[C@@H](C(O)=O)N)(O)=O |
| Synonyms | L-Serine O-phosphate; L-SOP |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 36 mg/mL (194.52 mM) | ||
| Ethanol | <1 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 54.03 mL | 270.17 mL | 540.34 mL |
| 0.5 mM | 10.81 mL | 54.03 mL | 108.07 mL |
| 1 mM | 5.4 mL | 27.02 mL | 54.03 mL |
| 5 mM | 1.08 mL | 5.4 mL | 10.81 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
