Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Oroxylin A is an O-methylated flavone, It has demonstrated activity as a dopamine reuptake inhibitor and is also a negative allosteric modulator of the benzodiazepine site of the GABAA receptor. |
|---|
| Catalog Num | A14367 |
|---|---|
| Formula | C16H12O5 |
| Molecular Weight | 284.27 |
| CAS Number | 480-11-5 |
| SMILES | COC1=C(C=C2C(=C1O)C(=O)C=C(O2)C3=CC=CC=C3)O |
| Synonyms | Oroxyline-A, OroxylinA |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL (186.44 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.18 mL | 175.89 mL | 351.78 mL |
| 0.5 mM | 7.04 mL | 35.18 mL | 70.36 mL |
| 1 mM | 3.52 mL | 17.59 mL | 35.18 mL |
| 5 mM | 0.7 mL | 3.52 mL | 7.04 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
