Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Ostarine is an androgen receptor modulator (SARM) |
|---|
| Catalog Num | A10253 |
|---|---|
| Formula | C19H14F3N3O3 |
| Molecular Weight | 389.3 |
| CAS Number | 1202044-20-9 |
| SMILES | C[C@](COC1=CC=C(C=C1)C#N)(C(=O)NC2=CC(=C(C=C2)C#N)C(F)(F)F)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 73 mg/mL (187.5 mM) | |
| Water | Insoluble | ||
| Ethanol | 73 mg/mL (187.5 mM) | ||
| In vivo | 1% DMSO+30% polyethylene glycol+1% Tween 80 | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.69 mL | 128.44 mL | 256.87 mL |
| 0.5 mM | 5.14 mL | 25.69 mL | 51.37 mL |
| 1 mM | 2.57 mL | 12.84 mL | 25.69 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
