Loading distributor info...
| Description | Oxybenzone is an organic compound used in sunscreens; provides broad-spectrum ultraviolet coverage, including UVB and short-wave UVA rays. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A16141 |
|---|---|
| Formula | C14H12O3 |
| Molecular Weight | 228.24 |
| CAS Number | 131-57-7 |
| SMILES | O=C(C1=CC=C(OC)C=C1O)C2=CC=CC=C2 |
| Synonyms | Eusolex 4360, Escalol 567 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 38 mg/mL (166.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 38 mg/mL (166.49 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 43.81 mL | 219.07 mL | 438.14 mL |
| 0.5 mM | 8.76 mL | 43.81 mL | 87.63 mL |
| 1 mM | 4.38 mL | 21.91 mL | 43.81 mL |
| 5 mM | 0.88 mL | 4.38 mL | 8.76 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
