Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Parthenolide ((-)-Parthenolide) is a sesquiterpene lactone which occurs naturally in the plant feverfew (Tanacetum parthenium). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10698 |
|---|---|
| Formula | C15H20O3 |
| Molecular Weight | 248.3 |
| CAS Number | 20554-84-1 |
| SMILES | C/C/1=C/CC[C@@]2([C@H](O2)[C@@H]3[C@@H](CC1)C(=C)C(=O)O3)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 49 mg/mL (197.32 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 49 mg/mL (197.32 mM) | ||
| In vivo | 2% DMSO+corn oil | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.27 mL | 201.37 mL | 402.74 mL |
| 0.5 mM | 8.05 mL | 40.27 mL | 80.55 mL |
| 1 mM | 4.03 mL | 20.14 mL | 40.27 mL |
| 5 mM | 0.81 mL | 4.03 mL | 8.05 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
