Loading distributor info...
| Description | PDM2 is a selective, high-affinity aryl hydrocarbon receptor (AhR) antagonist with an Ki of 1.2±0.4 nM. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A19860 |
|---|---|
| Formula | C14H9Cl3 |
| Molecular Weight | 283.58 |
| CAS Number | 688348-25-6 |
| SMILES | ClC1=CC=C(/C=C/C2=CC(Cl)=CC(Cl)=C2)C=C1 |
| Synonyms | PDM 2, PDM-2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (197.47 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (49.36 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.26 mL | 176.32 mL | 352.63 mL |
| 0.5 mM | 7.05 mL | 35.26 mL | 70.53 mL |
| 1 mM | 3.53 mL | 17.63 mL | 35.26 mL |
| 5 mM | 0.71 mL | 3.53 mL | 7.05 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
