Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pefloxacin mesylate is a synthetic chemotherapeutic agent and an antibacterial agent with IC5N/A of 6.7 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11902 |
|---|---|
| Formula | C17H20FN3O3.CH4O3S |
| Molecular Weight | 429.46 |
| CAS Number | 70458-95-6 |
| SMILES | CCN1C=C(C(=O)C2=CC(=C(C=C21)N3CCN(CC3)C)F)C(=O)O.CS(=O)(=O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 12 mg/mL (27.93 mM) | |
| Water | 57 mg/mL (132.72 mM) | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.29 mL | 116.43 mL | 232.85 mL |
| 0.5 mM | 4.66 mL | 23.29 mL | 46.57 mL |
| 1 mM | 2.33 mL | 11.64 mL | 23.29 mL |
| 5 mM | 0.47 mL | 2.33 mL | 4.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
