Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Peptide M is a 50 aa synthetic peptide derived from a streptococcal M protein containing an additional C-terminal cysteine residue. |
|---|
| Catalog Num | A21849 |
|---|---|
| Formula | C81H141N21O31 |
| Molecular Weight | 1905.11 |
| CAS Number | 110652-62-5 |
| SMILES | O=C(N[C@@H](CCC(O)=O)C(NCC(N[C@@H]([C@@H](C)CC)C(N[C@@H](CC(O)=O)C(N[C@@H](CCCCN)C(N[C@@H]([C@H](O)C)C(N[C@H](C(O)=O)C(C)C)=O)=O)=O)=O)=O)=O)[C@H](CCCCN)NC([C@H]([C@@H](C)CC)NC([C@H]([C@@H](C)CC)NC([C@H]([C@H](O)C)NC([C@H](CO)NC([C@H](CO)NC([C@H](C)NC([C@H](CC(C)C)NC([C@H](CC(N)=O)NC([C@H]([C@H](O)C)NC([C@@H](N)CC(O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
