Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Perindopril Butylamine Salt is an angiotensin-converting enzyme (ACE) inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10710 |
|---|---|
| Formula | C19H32N2O5.C4H11N |
| Molecular Weight | 441.61 |
| CAS Number | 107133-36-8 |
| SMILES | CCC[C@@H](C(=O)OCC)N[C@@H](C)C(=O)N1[C@H]2CCCC[C@H]2C[C@H]1C(=O)O.CC(C)(C)N |
| Synonyms | Perindopril, Coversyl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Insoluble | |
| Water | 86 mg/mL (194.74 mM) | ||
| Ethanol | 86 mg/mL (194.74 mM) | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.64 mL | 113.22 mL | 226.44 mL |
| 0.5 mM | 4.53 mL | 22.64 mL | 45.29 mL |
| 1 mM | 2.26 mL | 11.32 mL | 22.64 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
