Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-06726304 is a potent and SAM-competitive EZH2 (Enhancer of Zeste Homolog 2) lysine methyltransferase inhibitor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16937 |
|---|---|
| Formula | C22H21Cl2N3O3 |
| Molecular Weight | 446.32 |
| CAS Number | 1616287-82-1 |
| SMILES | O=C1N(CC2=C(C)C=C(C)NC2=O)CCC3=C1C(Cl)=C(C4=C(C)ON=C4C)C=C3Cl |
| Synonyms | PF 06726304, PF06726304 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 9 mg/mL (20.16 mM) | |
| Water | Insoluble | ||
| Ethanol | 20 mg/mL (44.81 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.41 mL | 112.03 mL | 224.05 mL |
| 0.5 mM | 4.48 mL | 22.41 mL | 44.81 mL |
| 1 mM | 2.24 mL | 11.2 mL | 22.41 mL |
| 5 mM | 0.45 mL | 2.24 mL | 4.48 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
