Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-4800567 is a potent and selective inhibitor of casein kinase 1ε (CK1ε), with an IC50 of 32 nM, which is greater than 20-fold selectivity over CK1δ (IC50, 711 nM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21381 |
|---|---|
| Formula | C17H18ClN5O2 |
| Molecular Weight | 359.81 |
| CAS Number | 1188296-52-7 |
| SMILES | NC1=C2C(N(C3CCOCC3)N=C2COC4=CC=CC(Cl)=C4)=NC=N1 |
| Synonyms | PF 4800567, PF4800567 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 70 mg/mL (194.54 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.79 mL | 138.96 mL | 277.92 mL |
| 0.5 mM | 5.56 mL | 27.79 mL | 55.58 mL |
| 1 mM | 2.78 mL | 13.9 mL | 27.79 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
