Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PF-9366 is a human methionine adenosyltransferase 2A (Mat2A) inhibitor, with an IC50 of 420 nM and a Kd of 170 nM. |
|---|
| Catalog Num | A19743 |
|---|---|
| Formula | C20H19ClN4 |
| Molecular Weight | 350.84 |
| CAS Number | 72882-78-1 |
| SMILES | CN(C)CCC1=NN=C2N1C3=CC=C(Cl)C=C3C(C4=CC=CC=C4)=C2 |
| Synonyms | PF9366, PF 9366 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 14 mg/mL (39.9 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 3 mg/mL (8.55 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.5 mL | 142.52 mL | 285.03 mL |
| 0.5 mM | 5.7 mL | 28.5 mL | 57.01 mL |
| 1 mM | 2.85 mL | 14.25 mL | 28.5 mL |
| 5 mM | 0.57 mL | 2.85 mL | 5.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
