Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Phentolamine is a reversible nonselective alpha-adrenergic antagonist. |
|---|
| Catalog Num | A11734 |
|---|---|
| Formula | C17H19N3O.CH4O3S |
| Molecular Weight | 377.5 |
| CAS Number | 65-28-1 |
| SMILES | CC1=CC=C(C=C1)N(CC2=NCCN2)C3=CC(=CC=C3)O.CS(=O)(=O)O |
| Synonyms | Regitine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (182.8 mM) | |
| Water | 69 mg/mL (182.8 mM) | ||
| Ethanol | 69 mg/mL (182.8 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.49 mL | 132.45 mL | 264.9 mL |
| 0.5 mM | 5.3 mL | 26.49 mL | 52.98 mL |
| 1 mM | 2.65 mL | 13.25 mL | 26.49 mL |
| 5 mM | 0.53 mL | 2.65 mL | 5.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
