Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Phlorizin is a competitive inhibitor of SGLT1 and SGLT2; this reduces renal glucose transport, lowering the amount of glucose in the blood. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10724 |
|---|---|
| Formula | C21H24O10 |
| Molecular Weight | 436.4 |
| CAS Number | 60-81-1 |
| SMILES | C1=CC(=CC=C1CCC(=O)C2=C(C=C(C=C2O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O)O)O)O)O |
| Synonyms | Phlorhizin, Phlorizoside |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 81 mg/mL (185.6 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 8 mg/mL (18.33 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.91 mL | 114.57 mL | 229.15 mL |
| 0.5 mM | 4.58 mL | 22.91 mL | 45.83 mL |
| 1 mM | 2.29 mL | 11.46 mL | 22.91 mL |
| 5 mM | 0.46 mL | 2.29 mL | 4.58 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
