Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PHTPP is a pyrazolo[1,5-α]pyrimidine-based ligand that acts as a full antagonist of estrogen ERβ receptors with 36-fold selectivity over ERα. |
|---|
| Catalog Num | A17035 |
|---|---|
| Formula | C20H11F6N3O |
| Molecular Weight | 423.3 |
| CAS Number | 805239-56-9 |
| SMILES | OC(C=C1)=CC=C1C(C(C2=CC=CC=C2)=N3)=C4N3C(C(F)(F)F)=CC(C(F)(F)F)=N4 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (115.75 mM) | |
| Water | Insoluble | ||
| Ethanol | 82 mg/mL (193.71 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.62 mL | 118.12 mL | 236.24 mL |
| 0.5 mM | 4.72 mL | 23.62 mL | 47.25 mL |
| 1 mM | 2.36 mL | 11.81 mL | 23.62 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.72 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
