Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pimavanserin is a potent and selective serotonin 5-HT2A inverse agonist with pIC50 of 8.73, used to treat psychosis associated with Parkinson?€?s disease. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15884 |
|---|---|
| Formula | C50H68F2N6O4.C4H6O6 |
| Molecular Weight | 1005.2 |
| CAS Number | 706782-28-7 |
| SMILES | CC(C)COC1=CC=C(C=C1)CNC(=O)N(CC2=CC=C(C=C2)F)C3CCN(CC3)C.CC(C)COC1=CC=C(C=C1)CNC(=O)N(CC2=CC=C(C=C2)F)C3CCN(CC3)C.C(C(C(=O)O)O)(C(=O)O)O |
| Synonyms | Pimavanserin tartrate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (94.51 mM) | |
| Water | 95 mg/mL (94.51 mM) | ||
| Ethanol | 95 mg/mL (94.51 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 9.95 mL | 49.74 mL | 99.48 mL |
| 0.5 mM | 1.99 mL | 9.95 mL | 19.9 mL |
| 1 mM | 0.99 mL | 4.97 mL | 9.95 mL |
| 5 mM | 0.2 mL | 0.99 mL | 1.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
