Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PKG drug G1 targets C42 of PKG Iα. PKG drug G1 can couple to vasodilation and blood pressure lowering by a C42 PKG Iα-independent mechanism. |
|---|
| Catalog Num | A19870 |
|---|---|
| Formula | C13H11N3OS |
| Molecular Weight | 257.31 |
| CAS Number | 374703-78-3 |
| SMILES | O=C(/C(N1)=C/C2=C(C)NC3=C2C=CC=C3)NC1=S |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (174.88 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (15.54 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 38.86 mL | 194.32 mL | 388.64 mL |
| 0.5 mM | 7.77 mL | 38.86 mL | 77.73 mL |
| 1 mM | 3.89 mL | 19.43 mL | 38.86 mL |
| 5 mM | 0.78 mL | 3.89 mL | 7.77 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
