Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Polygalasaponin F inhibits secretion of inflammatory cytokines via NF-kB pathway regulation. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14728 |
|---|---|
| Formula | C53H86O23 |
| Molecular Weight | 1091.24 |
| CAS Number | 882664-74-6 |
| SMILES | CC1C(C(C(C(O1)OC2C(C(C(OC2OC(=O)C34CCC(CC3C5=CCC6C(C5(CC4)C)(CCC7C6(CC(C(C7(C)CO)OC8C(C(C(C(O8)CO)O)O)O)O)C)C)(C)C)CO)O)O)O)O)OC9C(C(C(CO9)O)O)O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 90 mg/mL (82.47 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 9.16 mL | 45.82 mL | 91.64 mL |
| 0.5 mM | 1.83 mL | 9.16 mL | 18.33 mL |
| 1 mM | 0.92 mL | 4.58 mL | 9.16 mL |
| 5 mM | 0.18 mL | 0.92 mL | 1.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
