Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Pramiracetam is a nootropic drug derived from piracetam. |
|---|
| Catalog Num | A11710 |
|---|---|
| Formula | C14H27N3O2 |
| Molecular Weight | 269.4 |
| CAS Number | 68497-62-1 |
| SMILES | CC(C)N(CCNC(=O)CN1CCCC1=O)C(C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (185.61 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.12 mL | 185.6 mL | 371.2 mL |
| 0.5 mM | 7.42 mL | 37.12 mL | 74.24 mL |
| 1 mM | 3.71 mL | 18.56 mL | 37.12 mL |
| 5 mM | 0.74 mL | 3.71 mL | 7.42 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
