Pregnanolone, also known as eltanolone, is an endogenous inhibitory neurosteroid that is produced in the body from progesterone.
Loading distributor info...
| Description | Pregnanolone, also known as eltanolone, is an endogenous inhibitory neurosteroid that is produced in the body from progesterone. |
|---|
| Catalog Num | A14299 |
|---|---|
| Formula | C21H34O2 |
| Molecular Weight | 318.5 |
| CAS Number | 128-20-1 |
| SMILES | C[C@@]12[C@](CC[C@@H]2C(C)=O)([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC1 |
| Synonyms | Eltanolone |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
