Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | PTI-428 is a specific cystic fibrosis transmembrane conductance regulator (CFTR) amplifier. |
|---|
| Catalog Num | A20287 |
|---|---|
| Formula | C18H18N4O4 |
| Molecular Weight | 354.36 |
| CAS Number | 1953130-87-4 |
| SMILES | O=C(C1=CC(C2=CC=CC=C2)=NO1)N[C@H]3C[C@H](C4=NN=C([C@H](O)C)O4)C3 |
| Synonyms | PTI428, PTI 428 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 65 mg/mL (183.43 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.22 mL | 141.1 mL | 282.2 mL |
| 0.5 mM | 5.64 mL | 28.22 mL | 56.44 mL |
| 1 mM | 2.82 mL | 14.11 mL | 28.22 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
