Loading distributor info...
| Description | Pyrrolidinedithiocarbamate ammonium is a selective NF-kB inhibitor, inhibits translation of nitric oxide synthase mRNA to prevent induction. | |||||
|---|---|---|---|---|---|---|
| Targets |
| |||||
| Cell Research |
|
| Catalog Num | A16306 |
|---|---|
| Formula | C5H12N2S2 |
| Molecular Weight | 164.29 |
| CAS Number | 5108-96-3 |
| SMILES | C1CCN(C1)C(=S)[S-].[NH4+] |
| Synonyms | Ammonium pyrrolidinedithiocarbamate, APDC |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 29 mg/mL (176.51 mM) | |
| Water | 29 mg/mL (176.51 mM) | ||
| Ethanol | 29 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 60.87 mL | 304.34 mL | 608.68 mL |
| 0.5 mM | 12.17 mL | 60.87 mL | 121.74 mL |
| 1 mM | 6.09 mL | 30.43 mL | 60.87 mL |
| 5 mM | 1.22 mL | 6.09 mL | 12.17 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
