Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | R428 is a selective small molecule inhibitor of Axl kinase, which showed activity to blocks tumor spread and prolongs survival in models of metastatic breast cancer. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13741 |
|---|---|
| Formula | C30H34N8 |
| Molecular Weight | 506.64 |
| CAS Number | 1037624-75-1 |
| SMILES | C1CCN(C1)[C@H]2CCC3=C(CC2)C=C(C=C3)NC4=NN(C(=N4)N)C5=NN=C6C(=C5)CCCC7=CC=CC=C76 |
| Synonyms | BGB324, BGB 324, BGB-324, R-428 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 6 mg/mL (11.84 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 1 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.74 mL | 98.69 mL | 197.38 mL |
| 0.5 mM | 3.95 mL | 19.74 mL | 39.48 mL |
| 1 mM | 1.97 mL | 9.87 mL | 19.74 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.95 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
