Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RBC8 is a novel small molecule inhibitor of Ral GTPase; has IC50 of 3.5 μM in H2122 cell and 3.4 μM in H358 cell. |
|---|
| Catalog Num | A16681 |
|---|---|
| Formula | C25H20N4O3 |
| Molecular Weight | 424.45 |
| CAS Number | 361185-42-4 |
| SMILES | N#CC(C1C2=CC(OC)=CC=C2OC)=C(N)OC3=C1C(C4=CC=C5C=CC=CC5=C4)=NN3 |
| Synonyms | RBC 8, RBC-8 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (186.12 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.56 mL | 117.8 mL | 235.6 mL |
| 0.5 mM | 4.71 mL | 23.56 mL | 47.12 mL |
| 1 mM | 2.36 mL | 11.78 mL | 23.56 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.71 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
