Signaling Pathway
ROS1/TRK inhibitor
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Repotrectinib (TPX-0005) is a potent ROS1 (IC50=0.07 nM), TRK (0.83/0.05/0.1 nM=TRKA/B/C) inhibitor. |
|---|
| Catalog Num | A19850 |
|---|---|
| Formula | C18H18FN5O2 |
| Molecular Weight | 355.37 |
| CAS Number | 1802220-02-5 |
| SMILES | O=C1NC[C@H](C)OC2=CC=C(F)C=C2[C@@H](C)NC3=NC4=C1C=NN4C=C3 |
| Synonyms | TPX-0005, TPX0005, TP -0005 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 63 mg/mL (177.27 mM) | |
| Water | Insoluble | ||
| Ethanol | 9 mg/mL (25.32 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.14 mL | 140.7 mL | 281.4 mL |
| 0.5 mM | 5.63 mL | 28.14 mL | 56.28 mL |
| 1 mM | 2.81 mL | 14.07 mL | 28.14 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
