Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Resatorvid (TAK-242) is a selective Toll-like receptor 4 (TLR4) inhibitor and plays pivotal role in various inflammatory diseases. | |||||
|---|---|---|---|---|---|---|
| Targets |
|
|||||
| Cell Research |
|
| Catalog Num | A11543 |
|---|---|
| Formula | C15H17ClFNO4S |
| Molecular Weight | 361.82 |
| CAS Number | 243984-11-4 |
| SMILES | O=S([C@H]1C(C(OCC)=O)=CCCC1)(NC2=CC=C(C=C2Cl)F)=O |
| Synonyms | TAK-242; CLI-095 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 67 mg/mL (185.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 67 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.64 mL | 138.19 mL | 276.38 mL |
| 0.5 mM | 5.53 mL | 27.64 mL | 55.28 mL |
| 1 mM | 2.76 mL | 13.82 mL | 27.64 mL |
| 5 mM | 0.55 mL | 2.76 mL | 5.53 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
