Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Retinyl acetate is a vitamin A analog that induces cell differentiation and inhibits cell proliferation. |
|---|
| Catalog Num | A16783 |
|---|---|
| Formula | C22H32O2 |
| Molecular Weight | 328.49 |
| CAS Number | 127-47-9 |
| SMILES | CC(/C=C/C=C(/C=C/C1=C(CCCC(C)1C)C)C)=C\COC(C)=O |
| Synonyms | Vitamin A acetate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (173.52 mM) | |
| Water | Insoluble | ||
| Ethanol | 57 mg/mL (173.52 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.44 mL | 152.21 mL | 304.42 mL |
| 0.5 mM | 6.09 mL | 30.44 mL | 60.88 mL |
| 1 mM | 3.04 mL | 15.22 mL | 30.44 mL |
| 5 mM | 0.61 mL | 3.04 mL | 6.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
