Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Rheochrysidin is one of the major components of Da-Cheng-Qi decoction used in the treatment of inflammation. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10787 |
|---|---|
| Formula | C16H12O5 |
| Molecular Weight | 284.3 |
| CAS Number | 521-61-9 |
| SMILES | CC1=CC(=C2C(=C1)C(=O)C3=CC(=CC(=C3C2=O)O)OC)O |
| Synonyms | Physcion, Physcione, Parietin, Emodin 3-methyl ether, NSC 251670 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 1 mg/mL (3.51 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.17 mL | 175.87 mL | 351.74 mL |
| 0.5 mM | 7.03 mL | 35.17 mL | 70.35 mL |
| 1 mM | 3.52 mL | 17.59 mL | 35.17 mL |
| 5 mM | 0.7 mL | 3.52 mL | 7.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
