Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | RK-287107 is a potent and specific tankyrase inhibitor with IC50s of 14.3 and 10.6 nM for tankyrase-1 and tankyrase-2, respectively. RK-287107 blocks colorectal cancer cell growth. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19113 |
|---|---|
| Formula | C22H26F2N4O2 |
| Molecular Weight | 416.46 |
| CAS Number | 2171386-10-8 |
| SMILES | O=C1NC(N2CCC3(CC2)CN(CCO)C4=C3C(F)=CC(F)=C4)=NC5=C1CCCC5 |
| Synonyms | RK287107, RK 287107 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (194.49 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.01 mL | 120.06 mL | 240.12 mL |
| 0.5 mM | 4.8 mL | 24.01 mL | 48.02 mL |
| 1 mM | 2.4 mL | 12.01 mL | 24.01 mL |
| 5 mM | 0.48 mL | 2.4 mL | 4.8 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
