Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Roscovitine (Seliciclib) is a CDK inhibitor that preferentially inhibit multiple enzyme targets including CDK2, CDK7 and CDK9. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10806 |
|---|---|
| Formula | C19H26N6O |
| Molecular Weight | 354.5 |
| CAS Number | 186692-46-6 |
| SMILES | CC[C@H](CO)NC1=NC2=C(C(=N1)NCC3=CC=CC=C3)N=CN2C(C)C |
| Synonyms | CYC202, Seliciclib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 69 mg/mL (194.67 mM) | |
| Water | Insoluble | ||
| Ethanol | 6 mg/mL (16.92 mM) | ||
| In vivo | 1% DMSO+10% Tween 80+20% N-N-dimethylacetamide+69% PEG 400 | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.21 mL | 141.04 mL | 282.09 mL |
| 0.5 mM | 5.64 mL | 28.21 mL | 56.42 mL |
| 1 mM | 2.82 mL | 14.1 mL | 28.21 mL |
| 5 mM | 0.56 mL | 2.82 mL | 5.64 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
