Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Rottlerin, a natural product purified from Mallotus Philippinensis, is a specific PKC inhibitor, with IC50 values for PKCδ of 3-6 μM, PKCα,β,γ of 30-42 μM, PKCε,η,ζ of 80-100 μM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20743 |
|---|---|
| Formula | C30H28O8 |
| Molecular Weight | 516.54 |
| CAS Number | CAS: 82-08-6 |
| SMILES | O=C(C1=C2C(C=CC(C)(C)O2)=C(O)C(CC3=C(O)C(C)=C(O)C(C(C)=O)=C3O)=C1O)/C=C/C4=CC=CC=C4 |
| Synonyms | Mallotoxin; NSC 56346, NSC56346, NSC-56346; NSC 94525, NSC94525, NSC-94525 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 11 mg/mL (21.29 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | 1 mg/mL (1.93 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.36 mL | 96.8 mL | 193.6 mL |
| 0.5 mM | 3.87 mL | 19.36 mL | 38.72 mL |
| 1 mM | 1.94 mL | 9.68 mL | 19.36 mL |
| 5 mM | 0.39 mL | 1.94 mL | 3.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
