Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | S3I-201 (NSC 74859) is a novel inhibitor of Stat3 that inhibits Stat3, Stat3 complex formation and Stat3-DNA binding activity in vitro (IC50 = 86 ?? 33 μM) and Stat3-dependent transcriptional activities. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A10817 |
|---|---|
| Formula | C16H15NO7S |
| Molecular Weight | 365.4 |
| CAS Number | 501919-59-1 |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCC(=O)NC2=CC(=C(C=C2)C(=O)O)O |
| Synonyms | S3I201, NSC74859 , NSC-74859 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 66 mg/mL (180.64 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 2 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.37 mL | 136.84 mL | 273.67 mL |
| 0.5 mM | 5.47 mL | 27.37 mL | 54.73 mL |
| 1 mM | 2.74 mL | 13.68 mL | 27.37 mL |
| 5 mM | 0.55 mL | 2.74 mL | 5.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
