Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | S49076 is a novel, potent inhibitor of MET, AXL/MER, and FGFR1/2/3 with IC50 values below 20 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A21407 |
|---|---|
| Formula | C22H22N4O4S |
| Molecular Weight | 438.5 |
| CAS Number | 1265965-22-7 |
| SMILES | O=C(N1CC2=CC3=C(NC(/C3=C\C4=CC(CN5CCOCC5)=CN4)=O)C=C2)SCC1=O |
| Synonyms | S 49076, S-49076 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (180.16 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.81 mL | 114.03 mL | 228.05 mL |
| 0.5 mM | 4.56 mL | 22.81 mL | 45.61 mL |
| 1 mM | 2.28 mL | 11.4 mL | 22.81 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
