Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Salinomycin (Procoxacin) is an antibacterial and coccidiostat ionophore therapeutic agent. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A10822 |
|---|---|
| Formula | C42H70O11 |
| Molecular Weight | 751 |
| CAS Number | 53003-10-4 |
| SMILES | CC[C@H]([C@@H]1[C@H](C[C@H]([C@@]2(O1)C=C[C@H]([C@]3(O2)CC[C@@](O3)(C)[C@H]4CC[C@@]([C@@H](O4)C)(CC)O)O)C)C)C(=O)[C@@H](C)[C@H]([C@H](C)[C@H]5[C@H](CCC(O5)[C@@H](CC)C(=O)O)C)O |
| Synonyms | Procoxacin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 95 mg/mL (126.49 mM) | |
| Water | Insoluble | ||
| Ethanol | 75 mg/mL (99.86 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 13.32 mL | 66.58 mL | 133.16 mL |
| 0.5 mM | 2.66 mL | 13.32 mL | 26.63 mL |
| 1 mM | 1.33 mL | 6.66 mL | 13.32 mL |
| 5 mM | 0.27 mL | 1.33 mL | 2.66 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
