Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SB271046 Hydrochloride is a potent, selective and orally active 5-HT6 receptor antagonist with pKi of 8.9. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11573 |
|---|---|
| Formula | C20H23Cl2N3O3S2 |
| Molecular Weight | 488.45 |
| CAS Number | 209481-24-3 |
| SMILES | ClC1=CC2=C(C=C1)SC(S(=O)(NC3=CC=C(C(N4CCNCC4)=C3)OC)=O)=C2C.[H]Cl |
| Synonyms | SB 271046A |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 38 mg/mL (77.8 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 1% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.47 mL | 102.36 mL | 204.73 mL |
| 0.5 mM | 4.09 mL | 20.47 mL | 40.95 mL |
| 1 mM | 2.05 mL | 10.24 mL | 20.47 mL |
| 5 mM | 0.41 mL | 2.05 mL | 4.09 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
