Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Seclidemstat (SP-2577) is a potent and orally bioavailable LSD1 inhibitor, with a mean IC50 of 127 nM. |
|---|
| Catalog Num | A19730 |
|---|---|
| Formula | C20H23ClN4O4S |
| Molecular Weight | 450.94 |
| CAS Number | 1423715-37-0 |
| SMILES | O=C(N/N=C(C1=CC(Cl)=CC=C1O)\C)C2=CC=CC(S(=O)(N3CCN(C)CC3)=O)=C2 |
| Synonyms | SP-2577, SP2577, SP 2577 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 86 mg/mL (190.71 mM) | |
| Water | <1 mg/mL | ||
| Ethanol | <1 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.18 mL | 110.88 mL | 221.76 mL |
| 0.5 mM | 4.44 mL | 22.18 mL | 44.35 mL |
| 1 mM | 2.22 mL | 11.09 mL | 22.18 mL |
| 5 mM | 0.44 mL | 2.22 mL | 4.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
