Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Seletalisib is a novel small-molecule inhibitor of PI3Kδ with an IC50 value of 12 nM and shows significant selectivity to PI3Kδ with respect to the other class I PI3K isoforms (between 24- and 303-fold). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16797 |
|---|---|
| Formula | C23H14ClF3N6O |
| Molecular Weight | 482.85 |
| CAS Number | 1362850-20-1 |
| SMILES | FC(F)(F)[C@@H](C1=CC2=CC=CC(Cl)=C2N=C1C3=CC=C[N+]([O-])=C3)NC4=C5C(C=CC=N5)=NC=N4 |
| Synonyms | UCB-5857; UCB 5857; UCB5857; Seletalisib |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 89 mg/mL (184.32 mM) | |
| Water | Insoluble | ||
| Ethanol | 89 mg/mL (184.32 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.71 mL | 103.55 mL | 207.1 mL |
| 0.5 mM | 4.14 mL | 20.71 mL | 41.42 mL |
| 1 mM | 2.07 mL | 10.36 mL | 20.71 mL |
| 5 mM | 0.41 mL | 2.07 mL | 4.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
