Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Selitrectinib (LOXO-195) is a next-generation TRK kinase inhibitor (TKI), with IC50s of 0.6 nM, <2.5 nM for TRKA and TRKC respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19252 |
|---|---|
| Formula | C20H21FN6O |
| Molecular Weight | 380.42 |
| CAS Number | 2097002-61-2 |
| SMILES | FC1=CN=C(CC[C@H](N2)C)C([C@](CCC3)([H])N3C(C=CN4N=C5)=NC4=C5C2=O)=C1 |
| Synonyms | LOXO-195, LOXO 195, LOXO 195 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 35 mg/mL (91.99 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (36.8 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.29 mL | 131.43 mL | 262.87 mL |
| 0.5 mM | 5.26 mL | 26.29 mL | 52.57 mL |
| 1 mM | 2.63 mL | 13.14 mL | 26.29 mL |
| 5 mM | 0.53 mL | 2.63 mL | 5.26 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
