Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sirtinol is a cell-permeable, specific inhibitor of sirtuin NAD-dependant histone deacetylases. It is a specific SIRT1 and SIRT2 inhibitor with IC50 of 131 μM and 38 μM in cell-free assays, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12226 |
|---|---|
| Formula | C26H22N2O2 |
| Molecular Weight | 394.47 |
| CAS Number | 410536-97-9 |
| SMILES | O=C(N([H])C(C1=CC=CC=C1)C)C(C=CC=C2)=C2/N=C/C3=C(O)C=CC4=C3C=CC=C4 |
| Synonyms | Sir Two Inhibitor Naphthol |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 20 mg/mL (50.7 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 2% DMSO+30% PEG 300+5% Tween 80+ddH2O | 0.3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.35 mL | 126.75 mL | 253.5 mL |
| 0.5 mM | 5.07 mL | 25.35 mL | 50.7 mL |
| 1 mM | 2.54 mL | 12.68 mL | 25.35 mL |
| 5 mM | 0.51 mL | 2.54 mL | 5.07 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
