Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | SKI-II is a selective non-lipid inhibitor of sphingosine kinase (IC50 = 0.5 uM). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15988 |
|---|---|
| Formula | C15H11ClN2OS |
| Molecular Weight | 302.78 |
| CAS Number | 312636-16-1 |
| SMILES | OC1=CC=C(NC2=NC(C3=CC=C(Cl)C=C3)=CS2)C=C1 |
| Synonyms | SKI II, Sphingosine kinase inhibitor II |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 57 mg/mL (188.25 mM) | |
| Water | Insoluble | ||
| Ethanol | 57 mg/mL (188.25 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.03 mL | 165.14 mL | 330.27 mL |
| 0.5 mM | 6.61 mL | 33.03 mL | 66.05 mL |
| 1 mM | 3.3 mL | 16.51 mL | 33.03 mL |
| 5 mM | 0.66 mL | 3.3 mL | 6.61 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
