Loading distributor info...
| Description | SLV-2436 is a highly potent and ATP-competitive inhibitor of MNK1 and MNK2 with IC50s of 10.8 ?nM and 5.4 nM, respectively. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20294 |
|---|---|
| Formula | C19H15ClN4O |
| Molecular Weight | 350.8 |
| CAS Number | 2095704-43-9 |
| SMILES | O=C1C=CC(C2=CC3=C(C=C2)C(N)=NN3)=CN1CC4=CC=CC(Cl)=C4 |
| Synonyms | SLV2436, SLV 2436, SEL201-88, SEL-201-88, SEL 201-88; SEL-201, SEL201, SEL 201 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (188.14 mM) | |
| Water | Insoluble | ||
| Ethanol | 5 mg/mL (14.25 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.51 mL | 142.53 mL | 285.06 mL |
| 0.5 mM | 5.7 mL | 28.51 mL | 57.01 mL |
| 1 mM | 2.85 mL | 14.25 mL | 28.51 mL |
| 5 mM | 0.57 mL | 2.85 mL | 5.7 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
