Loading distributor info...
| Description | SN 6 is a selective Na+/Ca2+ exchanger (NCX) inhibitor, and inhibits 45Ca2+ uptake by NCX1, NCX2, and NCX3, with IC50s of 2.9, 16, and 8.6 μM, respectively. |
|---|
| Catalog Num | A19886 |
|---|---|
| Formula | C20H22N2O5S |
| Molecular Weight | 402.46 |
| CAS Number | 415697-08-4 |
| SMILES | CCOC(C(CS1)NC1CC2=CC=C(OCC3=CC=C([N+]([O-])=O)C=C3)C=C2)=O |
| Synonyms | SN-6; SN 6; SN6 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 74 mg/mL (183.86 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.85 mL | 124.24 mL | 248.47 mL |
| 0.5 mM | 4.97 mL | 24.85 mL | 49.69 mL |
| 1 mM | 2.48 mL | 12.42 mL | 24.85 mL |
| 5 mM | 0.5 mL | 2.48 mL | 4.97 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
