Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Sotrastaurin is a protein kinase C inhibitor for the prevention of transplant rejection and treatment of psoriasis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11554 |
|---|---|
| Formula | C25H22N6O2 |
| Molecular Weight | 438.5 |
| CAS Number | 425637-18-9 |
| SMILES | CN1CCN(CC1)C2=NC3=CC=CC=C3C(=N2)C4=C(C(=O)NC4=O)C5=CNC6=CC=CC=C65 |
| Synonyms | AEB 071, AEB-071 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 79 mg/mL (180.17 mM) | |
| Water | Insoluble | ||
| Ethanol | 2 mg/mL (4.56 mM) | ||
| In vivo | 2% DMSO+30% PEG 300+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.81 mL | 114.03 mL | 228.05 mL |
| 0.5 mM | 4.56 mL | 22.81 mL | 45.61 mL |
| 1 mM | 2.28 mL | 11.4 mL | 22.81 mL |
| 5 mM | 0.46 mL | 2.28 mL | 4.56 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
